
CAS 1258620-65-3
:2′-Methoxy[3,3′-bipyridin]-4-amine
Description:
2′-Methoxy[3,3′-bipyridin]-4-amine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a methoxy group (-OCH3) at the 2′ position and an amino group (-NH2) at the 4 position contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential for coordination with metal ions, making it of interest in coordination chemistry and catalysis. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially affecting its behavior in biological systems or as a ligand in metal complexes. Overall, 2′-Methoxy[3,3′-bipyridin]-4-amine is a versatile compound with implications in various fields, including medicinal chemistry and materials science.
Formula:C11H11N3O
InChI:InChI=1S/C11H11N3O/c1-15-11-8(3-2-5-14-11)9-7-13-6-4-10(9)12/h2-7H,1H3,(H2,12,13)
InChI key:InChIKey=SGRPJELMCQDKIS-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=N1)C=2C(N)=CC=NC2
Synonyms:- [3,3′-Bipyridin]-4-amine, 2′-methoxy-
- 2′-Methoxy[3,3′-bipyridin]-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
