CAS 1258624-32-6

6′-Chloro[3,3′-bipyridin]-4-amine

Description:

6′-Chloro[3,3′-bipyridin]-4-amine is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a chlorine atom at the 6′ position and an amino group at the 4 position contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and materials science. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its chemical properties can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating characteristics of the amino group, which can affect its behavior in chemical reactions, such as nucleophilic substitutions or coordination with metal ions. Additionally, the compound may have potential biological activity, making it of interest for further research in drug development or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₀H₈ClN₃

InChI: InChI=1S/C10H8ClN3/c11-10-2-1-7(5-14-10)8-6-13-4-3-9(8)12/h1-6H,(H2,12,13)

InChI key: InChIKey=JCXARWNGQVTMJG-UHFFFAOYSA-N

SMILES: NC=1C(C=2C=CC(Cl)=NC2)=CN=CC1

Synonyms:

• [3,3′-Bipyridin]-4-amine, 6′-chloro-
• 6′-Chloro[3,3′-bipyridin]-4-amine

6'-Chloro-[3,3'-bipyridin]-4-amine

CAS: 1258624-32-6

Formula: C₁₀H₈ClN₃

Molecular weight: 205.6436

Ref: IN-DA000OV1