CAS 1258625-27-2

2-Chloro-5-[2-(phenylmethoxy)phenyl]-4-pyridinecarboxylic acid

Description:

2-Chloro-5-[2-(phenylmethoxy)phenyl]-4-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and a chloro substituent. The presence of the phenylmethoxy group contributes to its aromatic character, enhancing its potential for interactions in biological systems. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while the carboxylic acid group may impart some polar characteristics, allowing for potential solubility in polar solvents. The chloro substituent can influence the compound's reactivity and stability, potentially affecting its biological activity. Such compounds are often studied for their pharmacological properties, including anti-inflammatory or anticancer activities, due to their ability to interact with various biological targets. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₉H₁₄ClNO₃

InChI: InChI=1S/C19H14ClNO3/c20-18-10-15(19(22)23)16(11-21-18)14-8-4-5-9-17(14)24-12-13-6-2-1-3-7-13/h1-11H,12H2,(H,22,23)

InChI key: InChIKey=CBPNNWAELMEFHK-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=C(Cl)C1)C2=C(OCC3=CC=CC=C3)C=CC=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 2-chloro-5-[2-(phenylmethoxy)phenyl]-
• 2-Chloro-5-[2-(phenylmethoxy)phenyl]-4-pyridinecarboxylic acid