
CAS 1258625-59-0
:3-[4-(Methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid
Description:
3-[4-(Methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid, identified by its CAS number 1258625-59-0, is an organic compound characterized by its complex structure that includes both pyridine and aromatic functionalities. This compound features a pyridine ring substituted at the 2-position with a carboxylic acid group and a phenyl group at the 4-position that is further substituted with a methoxycarbonyl group. The presence of the methoxycarbonyl group indicates that it can participate in various chemical reactions, such as esterification or nucleophilic substitution. The carboxylic acid functionality contributes to its acidic properties, making it soluble in polar solvents. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its structural features suggest potential uses in organic synthesis and medicinal chemistry, particularly in the development of new therapeutic agents. Overall, this compound represents a versatile building block in organic chemistry with potential implications in various fields.
Formula:C14H11NO4
InChI:InChI=1S/C14H11NO4/c1-19-14(18)10-6-4-9(5-7-10)11-3-2-8-15-12(11)13(16)17/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=NKKGQQQTDAKWSA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=N1)C2=CC=C(C(OC)=O)C=C2
Synonyms:- 3-[4-(Methoxycarbonyl)phenyl]-2-pyridinecarboxylic acid
- 2-Pyridinecarboxylic acid, 3-[4-(methoxycarbonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.