CymitQuimica logo

CAS 1258626-21-9

:

4-(2,4-Difluorophenyl)-2-pyridinecarboxylic acid

Description:
4-(2,4-Difluorophenyl)-2-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of the difluorophenyl substituent contributes to its distinct electronic properties, potentially influencing its reactivity and interactions with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the fluorine atoms can enhance metabolic stability and bioactivity. Additionally, the compound may participate in hydrogen bonding due to the carboxylic acid, affecting its physical properties such as melting point and boiling point. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, 4-(2,4-Difluorophenyl)-2-pyridinecarboxylic acid represents a valuable compound for research and development in various chemical and pharmaceutical applications.
Formula:C12H7F2NO2
InChI:InChI=1S/C12H7F2NO2/c13-8-1-2-9(10(14)6-8)7-3-4-15-11(5-7)12(16)17/h1-6H,(H,16,17)
InChI key:InChIKey=YWDILFQLNVGMGN-UHFFFAOYSA-N
SMILES:FC1=C(C=2C=C(C(O)=O)N=CC2)C=CC(F)=C1
Synonyms:
  • 4-(2,4-Difluorophenyl)-2-pyridinecarboxylic acid
  • 2-Pyridinecarboxylic acid, 4-(2,4-difluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.