CAS 1258633-19-0

5-Hydroxy-3′-(phenylmethoxy)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Hydroxy-3′-(phenylmethoxy)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) that contribute to its acidic properties and potential for hydrogen bonding. The presence of the phenylmethoxy group enhances its lipophilicity, which may influence its solubility and reactivity in various environments. The compound's molecular structure suggests potential applications in pharmaceuticals or as a biochemical probe due to its ability to interact with biological systems. Additionally, the hydroxyl and carboxylic acid functionalities may provide sites for further chemical modifications, making it a versatile building block in organic synthesis. Its CAS number, 1258633-19-0, allows for easy identification in chemical databases, facilitating research and development in related fields. Overall, this compound exemplifies the complexity and utility of organic molecules in scientific applications.

Formula: C₂₀H₁₆O₄

InChI: InChI=1S/C20H16O4/c21-18-10-16(9-17(11-18)20(22)23)15-7-4-8-19(12-15)24-13-14-5-2-1-3-6-14/h1-12,21H,13H2,(H,22,23)

InChI key: InChIKey=GYJSIOPOWDXAGL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(O)C1)C2=CC(OCC3=CC=CC=C3)=CC=C2

Synonyms:

• 5-Hydroxy-3′-(phenylmethoxy)[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 5-hydroxy-3′-(phenylmethoxy)-