CAS 1258635-47-0: 2′,4′-Difluoro-2-hydroxy[1,1′-biphenyl]-3-carboxylic acid

Description:2′,4′-Difluoro-2-hydroxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2′ and 4′ positions on one of the phenyl rings contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The hydroxyl group (-OH) at the 2-position and the carboxylic acid group (-COOH) at the 3-position enhance its polarity and solubility in polar solvents. This compound may exhibit interesting interactions in biological systems, making it a candidate for various applications in pharmaceuticals or agrochemicals. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can influence its reactivity and stability. As with many fluorinated compounds, it may also exhibit altered metabolic pathways compared to its non-fluorinated analogs. Overall, 2′,4′-Difluoro-2-hydroxy[1,1′-biphenyl]-3-carboxylic acid presents a unique combination of functional groups that could be explored for diverse chemical applications.

Formula:C₁₃H₈F₂O₃

InChI:InChI=1S/C13H8F2O3/c14-7-4-5-8(11(15)6-7)9-2-1-3-10(12(9)16)13(17)18/h1-6,16H,(H,17,18)

InChI key:InChIKey=GOAWZJPRUDKMRF-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=CC=C(C1O)C=2C=CC(F)=CC2F