
CAS 1258637-95-4
:2-[(4-Chlorophenyl)amino]-4,9-dihydro-4,9-dioxonaphtho[2,3-b]thiophene-3-carboxylic acid
Description:
2-[(4-Chlorophenyl)amino]-4,9-dihydro-4,9-dioxonaphtho[2,3-b]thiophene-3-carboxylic acid is a complex organic compound characterized by its unique structural features, including a naphtho[2,3-b]thiophene core, which contributes to its potential biological activity. The presence of a carboxylic acid functional group indicates acidic properties, while the 4-chlorophenyl amino group suggests potential interactions in biological systems, possibly influencing its pharmacological profile. The compound's dioxo groups imply that it may participate in various chemical reactions, including redox processes. Its molecular structure may confer specific solubility characteristics, affecting its bioavailability and interaction with biological targets. Additionally, the presence of chlorine in the phenyl ring can enhance lipophilicity, potentially influencing the compound's distribution in biological systems. Overall, this compound may exhibit interesting properties for research in medicinal chemistry, particularly in the development of therapeutic agents, although specific biological activities would require further investigation through experimental studies.
Formula:C19H10ClNO4S
InChI:InChI=1S/C19H10ClNO4S/c20-9-5-7-10(8-6-9)21-18-14(19(24)25)13-15(22)11-3-1-2-4-12(11)16(23)17(13)26-18/h1-8,21H,(H,24,25)
InChI key:InChIKey=ZIBFSOHYYUKGNW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(C(=O)C=3C(C2=O)=CC=CC3)SC1NC4=CC=C(Cl)C=C4
Synonyms:- 2-[(4-Chlorophenyl)amino]-4,9-dihydro-4,9-dioxonaphtho[2,3-b]thiophene-3-carboxylic acid
- Naphtho[2,3-b]thiophene-3-carboxylic acid, 2-[(4-chlorophenyl)amino]-4,9-dihydro-4,9-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.