CAS 1258638-40-2

Piperidine, 3,3-difluoro-4-phenyl-

Description:

Piperidine, 3,3-difluoro-4-phenyl- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of two fluorine atoms at the 3-position and a phenyl group at the 4-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atoms, which can influence its reactivity and solubility in various solvents. The phenyl group adds to its hydrophobic character, potentially affecting its interactions with biological systems. Piperidine derivatives are often studied for their pharmacological properties, and the introduction of fluorine can enhance biological activity or modify metabolic stability. As with many fluorinated compounds, it may also exhibit distinct physical properties, such as altered boiling and melting points compared to its non-fluorinated counterparts. Safety and handling precautions should be observed, as fluorinated compounds can pose specific health risks.

Formula: C₁₁H₁₃F₂N

InChI: InChI=1S/C11H13F2N/c12-11(13)8-14-7-6-10(11)9-4-2-1-3-5-9/h1-5,10,14H,6-8H2

InChI key: InChIKey=BAECOYBHZORNIT-UHFFFAOYSA-N

SMILES: FC1(F)C(C2=CC=CC=C2)CCNC1

Synonyms:

• Piperidine, 3,3-difluoro-4-phenyl-