CAS 1258639-52-9

1,2-Dihydro-5,7-dimethyl-2-oxopyrazolo[1,5-a]pyrimidine-6-acetic acid

Description:

1,2-Dihydro-5,7-dimethyl-2-oxopyrazolo[1,5-a]pyrimidine-6-acetic acid is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure. This compound features a fused ring system that includes both pyrazole and pyrimidine moieties, contributing to its potential biological activity. The presence of two methyl groups at the 5 and 7 positions enhances its lipophilicity, which may influence its interaction with biological targets. The acetic acid functional group at the 6 position introduces polar characteristics, potentially affecting solubility and reactivity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further research and characterization. As with many heterocycles, the stability and reactivity of this compound can be influenced by the electronic and steric effects of its substituents. Overall, 1,2-Dihydro-5,7-dimethyl-2-oxopyrazolo[1,5-a]pyrimidine-6-acetic acid represents a class of compounds that may hold promise for further exploration in drug development and other chemical applications.

Formula: C₁₀H₁₁N₃O₃

InChI: InChI=1S/C10H11N3O3/c1-5-7(3-10(15)16)6(2)13-8(11-5)4-9(14)12-13/h4H,3H2,1-2H3,(H,12,14)(H,15,16)

InChI key: InChIKey=RNOUPZUEZPCCEM-UHFFFAOYSA-N

SMILES: CC=1N2C(N=C(C)C1CC(O)=O)=CC(=O)N2

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-6-acetic acid, 1,2-dihydro-5,7-dimethyl-2-oxo-
• 1,2-Dihydro-5,7-dimethyl-2-oxopyrazolo[1,5-a]pyrimidine-6-acetic acid

2-{5,7-Dimethyl-2-oxo-1H,2H-pyrazolo[1,5-a]pyrimidin-6-yl}acetic acid

CAS: 1258639-52-9

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃O₃

Purity: Min. 95%

Molecular weight: 221.21 g/mol

Ref: 3D-IAC63952