CAS 1258639-53-0

Acetamide, 2-(cyclopentylamino)-, hydrochloride (1:1)

Description:

Acetamide, 2-(cyclopentylamino)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a cyclopentyl group attached to the nitrogen atom of the amide, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. The presence of the hydrochloride indicates that the compound is protonated, which can influence its reactivity and interaction with biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting the central nervous system or other physiological pathways. However, specific biological activity, toxicity, and detailed physicochemical properties would require further investigation through experimental studies and literature review.

Formula: C₇H₁₄N₂O·ClH

InChI: InChI=1S/C7H14N2O.ClH/c8-7(10)5-9-6-3-1-2-4-6;/h6,9H,1-5H2,(H2,8,10);1H

InChI key: InChIKey=NKHCKBBXSUJAGZ-UHFFFAOYSA-N

SMILES: N(CC(N)=O)C1CCCC1.Cl

Synonyms:

• Acetamide, 2-(cyclopentylamino)-, hydrochloride (1:1)

2-(Cyclopentylamino)acetamide hydrochloride

CAS: 1258639-53-0

Versatile small molecule scaffold

Formula: C₇H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 178.66 g/mol

Ref: 3D-IAC63953