CAS 1258639-54-1

1-Piperazineacetamide, α-methyl-N-2-propyn-1-yl-, hydrochloride (1:2)

Description:

1-Piperazineacetamide, α-methyl-N-2-propyn-1-yl-, hydrochloride (1:2) is a chemical compound characterized by its piperazine ring structure, which is a six-membered cyclic amine. This compound features an acetamide functional group and a propynyl substituent, contributing to its unique properties. The hydrochloride salt form indicates that it is a hydrochloride, which typically enhances solubility in water and stability. The presence of the α-methyl group suggests steric hindrance, which can influence the compound's biological activity and interaction with receptors. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with various biological targets, which could be explored for therapeutic applications. As with many piperazine derivatives, it may possess properties such as anxiolytic, antidepressant, or antipsychotic effects, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₇N₃O.2ClH

InChI: InChI=1S/C10H17N3O.2ClH/c1-3-4-12-10(14)9(2)13-7-5-11-6-8-13;;/h1,9,11H,4-8H2,2H3,(H,12,14);2*1H

InChI key: InChIKey=BOLQZLNNQYMJHE-UHFFFAOYSA-N

SMILES: C(C(NCC#C)=O)(C)N1CCNCC1.Cl

2-(Piperazin-1-yl)-N-(prop-2-yn-1-yl)propanamide dihydrochloride

CAS: 1258639-54-1

Versatile small molecule scaffold

Formula: C₁₀H₁₉Cl₂N₃O

Purity: Min. 95%

Molecular weight: 268.18 g/mol

Ref: 3D-IAC63954