CAS 1258639-55-2

Benzenemethanamine, 3-bromo-4-methoxy-α-phenyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3-bromo-4-methoxy-α-phenyl-, hydrochloride (1:1), with the CAS number 1258639-55-2, is a chemical compound characterized by its aromatic amine structure. It features a benzene ring substituted with a methoxy group and a bromine atom, contributing to its unique reactivity and potential biological activity. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, which often enhances solubility in water and stability. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its interactions in biological systems. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Additionally, the presence of both bromine and methoxy groups can affect the electronic properties of the molecule, potentially influencing its reactivity and interactions with other chemical species. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₁₄BrNO·ClH

InChI: InChI=1S/C14H14BrNO.ClH/c1-17-13-8-7-11(9-12(13)15)14(16)10-5-3-2-4-6-10;/h2-9,14H,16H2,1H3;1H

InChI key: InChIKey=NZIQRLRDJIKGOR-UHFFFAOYSA-N

SMILES: C(N)(C1=CC(Br)=C(OC)C=C1)C2=CC=CC=C2.Cl

Synonyms:

• Benzenemethanamine, 3-bromo-4-methoxy-α-phenyl-, hydrochloride (1:1)

(3-Bromo-4-methoxyphenyl)(phenyl)methanamine hydrochloride

CAS: 1258639-55-2

Versatile small molecule scaffold

Formula: C₁₄H₁₅BrClNO

Purity: Min. 95%

Molecular weight: 328.63 g/mol

Ref: 3D-IAC63955