CAS 1258639-69-8

4H-1,2,4-Triazole-3-methanamine, 4,5-dimethyl-, hydrochloride (1:2)

Description:

4H-1,2,4-Triazole-3-methanamine, 4,5-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance is typically encountered as a hydrochloride salt, indicating that it is protonated and exists in a stable ionic form. The presence of the 4,5-dimethyl substituents on the triazole ring contributes to its unique chemical properties, potentially influencing its solubility and reactivity. As a triazole derivative, it may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antifungal or antimicrobial agents. The compound's molecular interactions are likely influenced by the functional groups present, which can participate in hydrogen bonding and other intermolecular forces. Its specific applications and behavior in various chemical environments would depend on further studies, including its synthesis, stability, and potential therapeutic uses.

Formula: C₅H₁₀N₄·2ClH

InChI: InChI=1S/C5H10N4.2ClH/c1-4-7-8-5(3-6)9(4)2;;/h3,6H2,1-2H3;2*1H

InChI key: InChIKey=KAELDAFSYHVIFS-UHFFFAOYSA-N

SMILES: C(N)C=1N(C)C(C)=NN1.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, 4,5-dimethyl-, hydrochloride (1:2)

(Dimethyl-4H-1,2,4-triazol-3-yl)methanamine dihydrochloride

CAS: 1258639-69-8

Versatile small molecule scaffold

Formula: C₅H₁₂Cl₂N₄

Purity: Min. 95%

Molecular weight: 199.08 g/mol

Ref: 3D-IAC63969