CAS 1258639-75-6

Piperazine, 1-(1,2,4-oxadiazol-3-ylmethyl)-, hydrochloride (1:2)

Description:

Piperazine, 1-(1,2,4-oxadiazol-3-ylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine backbone, which is a six-membered heterocyclic amine. The presence of the 1,2,4-oxadiazole moiety introduces unique properties, including potential biological activity, as oxadiazoles are often associated with pharmacological effects. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in medicinal chemistry. The molecular structure suggests that it may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological activities would depend on further empirical studies. Its CAS number, 1258639-75-6, allows for precise identification in chemical databases. As with many piperazine derivatives, it may also serve as a scaffold for the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₇H₁₂N₄O·2ClH

InChI: InChI=1S/C7H12N4O.2ClH/c1-3-11(4-2-8-1)5-7-9-6-12-10-7;;/h6,8H,1-5H2;2*1H

InChI key: InChIKey=ZOTKGVGEWSZYAP-UHFFFAOYSA-N

SMILES: C(N1CCNCC1)C=2N=CON2.Cl

Synonyms:

• Piperazine, 1-(1,2,4-oxadiazol-3-ylmethyl)-, hydrochloride (1:2)

1-(1,2,4-Oxadiazol-3-ylmethyl)piperazine dihydrochloride

CAS: 1258639-75-6

Versatile small molecule scaffold

Formula: C₇H₁₄Cl₂N₄O

Purity: Min. 95%

Molecular weight: 241.12 g/mol

Ref: 3D-IAC63975