
CAS 1258640-12-8
:4-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-5,5,5-trifluoropentanoic acid
Description:
4-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-5,5,5-trifluoropentanoic acid is a synthetic organic compound characterized by its complex structure, which includes a trifluoromethyl group and a dimethylethoxycarbonyl moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The dimethylethoxycarbonyl group serves as a protective or modifying group, which can be important in synthetic pathways or in enhancing the stability of the molecule. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutics. Its unique characteristics, including the trifluoromethyl and carboxylic acid functionalities, may also impart specific reactivity patterns, making it suitable for various chemical reactions. As with many fluorinated compounds, it may exhibit distinct physical and chemical properties compared to its non-fluorinated analogs, such as altered solubility and reactivity.
Formula:C11H18F3NO4
InChI:InChI=1S/C11H18F3NO4/c1-10(2,3)19-9(18)15-6-7(11(12,13)14)4-5-8(16)17/h7H,4-6H2,1-3H3,(H,15,18)(H,16,17)
InChI key:InChIKey=FXYVLZDJFMXCCK-UHFFFAOYSA-N
SMILES:C(CNC(OC(C)(C)C)=O)(CCC(O)=O)C(F)(F)F
Synonyms:- 4-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-5,5,5-trifluoropentanoic acid
- Pentanoic acid, 4-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-5,5,5-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.