CAS 1258640-22-0

2-(2-Chloro-4-pyridinyl)-6-methyl-4(3H)-pyrimidinone

Description:

2-(2-Chloro-4-pyridinyl)-6-methyl-4(3H)-pyrimidinone is a chemical compound characterized by its pyrimidinone core structure, which features a pyridine ring substituted with a chlorine atom and a methyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of nitrogen atoms in its heterocyclic rings, which can engage in hydrogen bonding. The chlorine substituent can influence its reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. The compound may also exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific enzymes or receptors. As with many heterocyclic compounds, it may display a range of biological activities, including antimicrobial or anticancer properties, depending on its specific interactions within biological systems. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₈ClN₃O

InChI: InChI=1S/C10H8ClN3O/c1-6-4-9(15)14-10(13-6)7-2-3-12-8(11)5-7/h2-5H,1H3,(H,13,14,15)

InChI key: InChIKey=ZKHMGYNSHSXSJW-UHFFFAOYSA-N

SMILES: CC=1NC(=NC(=O)C1)C=2C=C(Cl)N=CC2

Synonyms:

• 4(3H)-Pyrimidinone, 2-(2-chloro-4-pyridinyl)-6-methyl-
• 2-(2-Chloro-4-pyridinyl)-6-methyl-4(3H)-pyrimidinone

2-(2-Chloropyridin-4-yl)-6-methyl-3,4-dihydropyrimidin-4-one

CAS: 1258640-22-0

Versatile small molecule scaffold

Formula: C₁₀H₈ClN₃O

Purity: Min. 95%

Molecular weight: 221.64 g/mol

Ref: 3D-IAC64022