CAS 1258640-23-1

1-Amino-3-[4-(trifluoromethyl)phenyl]cyclobutanecarboxylic acid

Description:

1-Amino-3-[4-(trifluoromethyl)phenyl]cyclobutanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclobutane ring, an amino group, and a carboxylic acid functional group. The presence of a trifluoromethyl group attached to a phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound may exhibit interesting pharmacological properties due to the combination of its amino acid structure and the electron-withdrawing trifluoromethyl group, which can modulate interactions with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the cyclobutane moiety may contribute to conformational rigidity, which can be advantageous in drug design. As with many fluorinated compounds, it may also exhibit unique stability and reactivity patterns. Overall, 1-Amino-3-[4-(trifluoromethyl)phenyl]cyclobutanecarboxylic acid represents a compound of interest for further research in both synthetic and medicinal chemistry.

Formula: C₁₂H₁₂F₃NO₂

InChI: InChI=1S/C12H12F3NO2/c13-12(14,15)9-3-1-7(2-4-9)8-5-11(16,6-8)10(17)18/h1-4,8H,5-6,16H2,(H,17,18)

InChI key: InChIKey=UFUYOBOYDMVNHD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)CC(C1)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 1-Amino-3-[4-(trifluoromethyl)phenyl]cyclobutanecarboxylic acid
• Cyclobutanecarboxylic acid, 1-amino-3-[4-(trifluoromethyl)phenyl]-