CAS 1258640-31-1

5-(Trifluoromethyl)-2-pyrrolidineacetic acid

Description:

5-(Trifluoromethyl)-2-pyrrolidineacetic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a trifluoromethyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound is typically classified as an amino acid derivative due to the presence of both an amine and a carboxylic acid functional group. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug design. The compound may exhibit interesting pharmacological properties, potentially acting as a modulator or inhibitor in biological systems. Additionally, its stability and reactivity can be influenced by the trifluoromethyl group, which can participate in various chemical reactions. Overall, 5-(Trifluoromethyl)-2-pyrrolidineacetic acid represents a valuable compound for research in organic synthesis and pharmaceutical applications, although specific applications and biological effects would require further investigation.

Formula: C₇H₁₀F₃NO₂

InChI: InChI=1S/C7H10F3NO2/c8-7(9,10)5-2-1-4(11-5)3-6(12)13/h4-5,11H,1-3H2,(H,12,13)

InChI key: InChIKey=RZXZONFTCIMTPA-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1NC(CC(O)=O)CC1

Synonyms:

• 5-(Trifluoromethyl)-2-pyrrolidineacetic acid
• 2-Pyrrolidineacetic acid, 5-(trifluoromethyl)-