CymitQuimica logo

CAS 1258640-52-6

:

2-Amino-4-methoxy-5-(methylthio)benzoic acid

Description:
2-Amino-4-methoxy-5-(methylthio)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, a methoxy group, and a methylthio group. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The methoxy group (-OCH3) is an electron-donating group that can influence the compound's reactivity and stability, while the methylthio group (-S-CH3) can impart unique properties related to sulfur chemistry. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological targets. Additionally, the presence of functional groups allows for various chemical reactions, such as esterification or amide formation, which can be utilized in synthetic pathways. Overall, 2-Amino-4-methoxy-5-(methylthio)benzoic acid is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C9H11NO3S
InChI:InChI=1S/C9H11NO3S/c1-13-7-4-6(10)5(9(11)12)3-8(7)14-2/h3-4H,10H2,1-2H3,(H,11,12)
InChI key:InChIKey=NGRMTODNLMERFW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C=C(OC)C(SC)=C1
Synonyms:
  • Benzoic acid, 2-amino-4-methoxy-5-(methylthio)-
  • 2-Amino-4-methoxy-5-(methylthio)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.