CymitQuimica logo

CAS 1258640-54-8

:

2-(4-Pyridinyl)-1H-indol-3-ol

Description:
2-(4-Pyridinyl)-1H-indol-3-ol, identified by its CAS number 1258640-54-8, is a chemical compound that features a fused indole and pyridine structure, which contributes to its unique properties. This compound typically exhibits a solid-state form and is characterized by its aromatic nature, which can influence its reactivity and interactions with other molecules. The presence of the hydroxyl group (-OH) at the indole position enhances its potential for hydrogen bonding, making it a candidate for various biological activities. Additionally, the pyridine ring can participate in coordination with metal ions, potentially leading to applications in coordination chemistry or as a ligand in catalysis. The compound may also exhibit fluorescence properties, making it useful in certain analytical applications. Its structural features suggest potential pharmacological activities, warranting further investigation in medicinal chemistry. Overall, 2-(4-Pyridinyl)-1H-indol-3-ol represents a versatile scaffold for research in both organic synthesis and biological applications.
Formula:C13H10N2O
InChI:InChI=1S/C13H10N2O/c16-13-10-3-1-2-4-11(10)15-12(13)9-5-7-14-8-6-9/h1-8,15-16H
InChI key:InChIKey=NTAKRIIQRZZJMK-UHFFFAOYSA-N
SMILES:OC1=C(NC=2C1=CC=CC2)C=3C=CN=CC3
Synonyms:
  • 2-(4-Pyridinyl)-1H-indol-3-ol
  • 1H-Indol-3-ol, 2-(4-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.