CAS 1258640-56-0

Benzenemethanamine, N-methyl-2-(2-propyn-1-yloxy)-, hydrochloride (1:1)

Description:

Benzenemethanamine, N-methyl-2-(2-propyn-1-yloxy)-, hydrochloride (1:1) is a chemical compound characterized by its amine and ether functional groups, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the benzenemethanamine structure indicates that it possesses aromatic characteristics, which can influence its stability and interaction with biological systems. The N-methyl group enhances lipophilicity, potentially improving the compound's ability to cross biological membranes. The propynyl ether moiety introduces a degree of unsaturation and may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for formulation in pharmaceutical applications. Overall, this compound's unique structural features suggest potential utility in drug development or as a building block in synthetic organic chemistry, although specific biological activities and safety profiles would require further investigation.

Formula: C₁₁H₁₃NO·ClH

InChI: InChI=1S/C11H13NO.ClH/c1-3-8-13-11-7-5-4-6-10(11)9-12-2;/h1,4-7,12H,8-9H2,2H3;1H

InChI key: InChIKey=KAKNIBJSDRDYNF-UHFFFAOYSA-N

SMILES: O(CC#C)C1=C(CNC)C=CC=C1.Cl

Synonyms:

• Methyl({[2-(prop-2-yn-1-yloxy)phenyl]methyl})amine hydrochloride
• Benzenemethanamine, N-methyl-2-(2-propyn-1-yloxy)-, hydrochloride (1:1)

Methyl({[2-(prop-2-yn-1-yloxy)phenyl]methyl})amine hydrochloride

CAS: 1258640-56-0

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClNO

Purity: Min. 95%

Molecular weight: 211.69 g/mol

Ref: 3D-IAC64056