CAS 1258640-67-3

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-(trifluoromethyl)pentanoic acid

Description:

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-(trifluoromethyl)pentanoic acid is a synthetic organic compound characterized by its complex structure, which includes a pentanoic acid backbone with a trifluoromethyl group and a dimethylethoxycarbonyl amino substituent. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique functional groups that may interact with biological targets. The presence of the trifluoromethyl group enhances lipophilicity and metabolic stability, which can influence the compound's pharmacokinetic properties. Additionally, the dimethylethoxycarbonyl group serves as a protective moiety, often utilized in peptide synthesis and other organic transformations. The compound's solubility, reactivity, and stability are influenced by these substituents, making it a subject of interest in drug design and development. As with many synthetic compounds, safety and handling precautions should be observed, given the potential hazards associated with its chemical properties.

Formula: C₁₁H₁₈F₃NO₄

InChI: InChI=1S/C11H18F3NO4/c1-10(2,3)19-9(18)15-5-4-7(6-8(16)17)11(12,13)14/h7H,4-6H2,1-3H3,(H,15,18)(H,16,17)

InChI key: InChIKey=VBVHGWGVTGSANP-UHFFFAOYSA-N

SMILES: C(CCNC(OC(C)(C)C)=O)(CC(O)=O)C(F)(F)F

Synonyms:

• 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-3-(trifluoromethyl)pentanoic acid
• Pentanoic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-3-(trifluoromethyl)-