CymitQuimica logo

CAS 1258640-70-8

:

4,5-Dihydro-α-(phenylmethyl)-3-isoxazolemethanamine

Description:
4,5-Dihydro-α-(phenylmethyl)-3-isoxazolemethanamine, identified by its CAS number 1258640-70-8, is a chemical compound that features a unique isoxazole ring structure, which contributes to its potential biological activity. This compound is characterized by the presence of a phenylmethyl group, which may influence its interaction with biological targets, potentially affecting its pharmacological properties. The isoxazole moiety is known for its role in various medicinal chemistry applications, often exhibiting neuroactive or anti-inflammatory properties. The presence of the amine functional group suggests that it may participate in hydrogen bonding, enhancing its solubility and reactivity. Additionally, the dihydro configuration indicates that the compound may exist in a specific stereochemical form, which can be crucial for its biological efficacy. Overall, the structural features of 4,5-Dihydro-α-(phenylmethyl)-3-isoxazolemethanamine suggest that it could be of interest in drug development, particularly in areas related to central nervous system disorders or other therapeutic applications.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c12-10(11-6-7-14-13-11)8-9-4-2-1-3-5-9/h1-5,10H,6-8,12H2
InChI key:InChIKey=LLHIFUOYSVXZEC-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(N)C=2CCON2
Synonyms:
  • 3-Isoxazolemethanamine, 4,5-dihydro-α-(phenylmethyl)-
  • 4,5-Dihydro-α-(phenylmethyl)-3-isoxazolemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.