
CAS 1258640-73-1
:6-Bromo-2,3-dihydro-α-methyl-1H-indole-3-methanol
Description:
6-Bromo-2,3-dihydro-α-methyl-1H-indole-3-methanol is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a hydroxymethyl group at the 3-position contributes to its unique reactivity and potential biological activity. The α-methyl group enhances its steric properties, influencing its interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas related to neurochemistry or as a precursor for synthesizing other bioactive compounds. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many indole derivatives, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions, which can be exploited in synthetic organic chemistry.
Formula:C10H12BrNO
InChI:InChI=1S/C10H12BrNO/c1-6(13)9-5-12-10-4-7(11)2-3-8(9)10/h2-4,6,9,12-13H,5H2,1H3
InChI key:InChIKey=BERTXOJABVEMKO-UHFFFAOYSA-N
SMILES:C(C)(O)C1C=2C(NC1)=CC(Br)=CC2
Synonyms:- 6-Bromo-2,3-dihydro-α-methyl-1H-indole-3-methanol
- 1H-Indole-3-methanol, 6-bromo-2,3-dihydro-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.