CAS 1258640-96-8

Benzenecarboximidamide, 4-(1,1-dioxido-4-thiomorpholinyl)-, hydrochloride (1:1)

Description:

Benzenecarboximidamide, 4-(1,1-dioxido-4-thiomorpholinyl)-, hydrochloride (1:1), with the CAS number 1258640-96-8, is a chemical compound characterized by its unique structural features, including a benzenecarboximidamide moiety and a thiomorpholine ring that contains a sulfonyl group. This compound typically appears as a hydrochloride salt, which enhances its solubility in aqueous solutions, making it suitable for various applications in pharmaceutical and biochemical research. The presence of the thiomorpholine ring contributes to its potential biological activity, possibly influencing its interaction with biological targets. The dioxido group may also play a role in the compound's reactivity and stability. As a hydrochloride, it is likely to exhibit properties typical of amides and imides, such as moderate polarity and the ability to form hydrogen bonds. Overall, this compound's characteristics suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₁H₁₅N₃O₂S·ClH

InChI: InChI=1S/C11H15N3O2S.ClH/c12-11(13)9-1-3-10(4-2-9)14-5-7-17(15,16)8-6-14;/h1-4H,5-8H2,(H3,12,13);1H

InChI key: InChIKey=PCSBJDAIWZPOJZ-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC=C(C=C1)N2CCS(=O)(=O)CC2.Cl

Synonyms:

• Benzenecarboximidamide, 4-(1,1-dioxido-4-thiomorpholinyl)-, hydrochloride (1:1)

4-(1,1-Dioxo-1λ⁶-thiomorpholin-4-yl)benzene-1-carboximidamide hydrochloride

CAS: 1258640-96-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClN₃O₂S

Purity: Min. 95%

Molecular weight: 289.78 g/mol

Ref: 3D-IAC64096