CAS 1258640-99-1

2-Thiazolebutanamine, 4-(3-pyridinyl)-, hydrochloride (1:2)

Description:

2-Thiazolebutanamine, 4-(3-pyridinyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyridine moiety. This compound typically appears as a hydrochloride salt, indicating that it is soluble in water and may exhibit different properties compared to its free base form. The presence of both thiazole and pyridine suggests potential biological activity, as these heterocyclic compounds are often found in pharmaceuticals and agrochemicals. The compound may exhibit properties such as moderate to high polarity due to the presence of nitrogen and sulfur atoms in its structure, which can influence its solubility and reactivity. Additionally, the specific arrangement of functional groups can affect its interaction with biological targets, making it of interest in medicinal chemistry. As with many compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be evaluated in detail for any practical applications.

Formula: C₁₂H₁₅N₃S.2ClH

InChI: InChI=1S/C12H15N3S.2ClH/c13-6-2-1-5-12-15-11(9-16-12)10-4-3-7-14-8-10;;/h3-4,7-9H,1-2,5-6,13H2;2*1H

InChI key: InChIKey=MSOTVFKMVJQSCO-UHFFFAOYSA-N

SMILES: C(CCCN)C1=NC(=CS1)C=2C=CC=NC2.Cl

4-[4-(Pyridin-3-yl)-1,3-thiazol-2-yl]butan-1-amine dihydrochloride

CAS: 1258640-99-1

Versatile small molecule scaffold

Formula: C₁₂H₁₇Cl₂N₃S

Purity: Min. 95%

Molecular weight: 306.3 g/mol

Ref: 3D-IAC64099