CAS 1258641-00-7

1-[4-(1-Aminoethyl)phenyl]-2-pyrrolidinone

Description:

1-[4-(1-Aminoethyl)phenyl]-2-pyrrolidinone, identified by its CAS number 1258641-00-7, is a chemical compound that features a pyrrolidinone ring substituted with an aminoethyl group and a phenyl moiety. This structure suggests that it may exhibit properties typical of both amines and cyclic amides, potentially influencing its reactivity and interactions. The presence of the amino group indicates that it may participate in hydrogen bonding, which can affect its solubility and stability in various solvents. Additionally, the phenyl group may contribute to the compound's hydrophobic characteristics, influencing its biological activity and pharmacokinetics. Such compounds often find applications in medicinal chemistry, potentially serving as intermediates in the synthesis of pharmaceuticals or as active pharmaceutical ingredients themselves. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is measured. Overall, this compound's unique structure suggests potential utility in various chemical and biological applications.

Formula: C₁₂H₁₆N₂O

InChI: InChI=1S/C12H16N2O/c1-9(13)10-4-6-11(7-5-10)14-8-2-3-12(14)15/h4-7,9H,2-3,8,13H2,1H3

InChI key: InChIKey=IIPWVKDPLQHHNR-UHFFFAOYSA-N

SMILES: O=C1N(CCC1)C2=CC=C(C(C)N)C=C2

Synonyms:

• 1-[4-(1-Aminoethyl)phenyl]-2-pyrrolidinone
• 2-Pyrrolidinone, 1-[4-(1-aminoethyl)phenyl]-

1-[4-(1-Aminoethyl)phenyl]pyrrolidin-2-one

CAS: 1258641-00-7

Versatile small molecule scaffold

Formula: C₁₂H₁₆N₂O

Purity: Min. 95%

Molecular weight: 204.27 g/mol

Ref: 3D-IAC64100