CAS 1258641-03-0

2,3-Dihydro-2,4,6-trimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-5-acetic acid

Description:

2,3-Dihydro-2,4,6-trimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-5-acetic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyridine framework. This compound features a dihydro-pyrazole ring, contributing to its unique reactivity and potential biological activity. The presence of multiple methyl groups enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The carboxylic acid functional group at the 5-position is significant for its acidity and potential for forming salts or esters, which can affect its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific applications and effects would depend on further research, including studies on its mechanism of action and potential therapeutic uses. Overall, the structural features of this compound suggest it could be a candidate for further investigation in the fields of organic synthesis and pharmacology.

Formula: C₁₁H₁₃N₃O₃

InChI: InChI=1S/C11H13N3O3/c1-5-7(4-8(15)16)6(2)12-10-9(5)11(17)14(3)13-10/h4H2,1-3H3,(H,12,13)(H,15,16)

InChI key: InChIKey=WPVQJJMDTRCQOR-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC(C)=C1CC(O)=O)NN(C)C2=O

Synonyms:

• 2,3-Dihydro-2,4,6-trimethyl-3-oxo-1H-pyrazolo[3,4-b]pyridine-5-acetic acid
• 1H-Pyrazolo[3,4-b]pyridine-5-acetic acid, 2,3-dihydro-2,4,6-trimethyl-3-oxo-