CymitQuimica logo

CAS 1258641-29-0

:

4-(Chloromethyl)-2-[4-(methylsulfonyl)phenyl]thiazole

Description:
4-(Chloromethyl)-2-[4-(methylsulfonyl)phenyl]thiazole is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a chloromethyl group indicates that it has a chlorine atom attached to a carbon chain, which can enhance its reactivity, particularly in nucleophilic substitution reactions. The compound also features a methylsulfonyl group, which is known for its ability to act as a leaving group in various chemical reactions and can influence the compound's solubility and polarity. This compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where thiazole derivatives are often explored for their diverse biological properties. Additionally, the presence of functional groups like chloromethyl and methylsulfonyl can affect the compound's reactivity, stability, and interaction with other molecules.
Formula:C11H10ClNO2S2
InChI:InChI=1S/C11H10ClNO2S2/c1-17(14,15)10-4-2-8(3-5-10)11-13-9(6-12)7-16-11/h2-5,7H,6H2,1H3
InChI key:InChIKey=PMWZRHLBRPZKSV-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(SC1)C2=CC=C(S(C)(=O)=O)C=C2
Synonyms:
  • 4-(Chloromethyl)-2-[4-(methylsulfonyl)phenyl]thiazole
  • Thiazole, 4-(chloromethyl)-2-[4-(methylsulfonyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.