CymitQuimica logo

CAS 1258641-34-7

:

5-Amino-3-(trifluoromethyl)pentanoic acid

Description:
5-Amino-3-(trifluoromethyl)pentanoic acid is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a pentanoic acid backbone. This compound features a five-carbon chain with a carboxylic acid functional group at one end and an amino group at the second carbon, making it an amino acid derivative. The trifluoromethyl group, which consists of three fluorine atoms bonded to a carbon atom, imparts unique electronic and steric properties, influencing the compound's reactivity and solubility. This substance may exhibit interesting biological activities due to its structural features, potentially serving as a building block in pharmaceuticals or agrochemicals. Its molecular structure suggests it could participate in various chemical reactions, including those typical of amino acids, such as peptide bond formation. Additionally, the presence of fluorine atoms can enhance lipophilicity and metabolic stability, making it a subject of interest in medicinal chemistry. As with many fluorinated compounds, safety and environmental considerations are essential when handling and utilizing this substance.
Formula:C6H10F3NO2
InChI:InChI=1S/C6H10F3NO2/c7-6(8,9)4(1-2-10)3-5(11)12/h4H,1-3,10H2,(H,11,12)
InChI key:InChIKey=NBFMNAOCYLBNGU-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(CC(O)=O)CCN
Synonyms:
  • Pentanoic acid, 5-amino-3-(trifluoromethyl)-
  • 5-Amino-3-(trifluoromethyl)pentanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.