CAS 1258641-43-8

Phenol, 4-[1-(cyclopropylamino)ethyl]-, hydrochloride (1:1)

Description:

Phenol, 4-[1-(cyclopropylamino)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a cyclopropylamino group indicates that it has a cyclopropyl ring bonded to an amino group, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit specific pharmacological effects due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the cyclopropyl group, which may affect its binding affinity to biological targets. Safety and handling precautions are essential, as with many phenolic compounds, due to potential toxicity and reactivity. Overall, this compound represents a blend of organic chemistry and pharmacology, with implications for drug development and therapeutic applications.

Formula: C₁₁H₁₅NO·ClH

InChI: InChI=1S/C11H15NO.ClH/c1-8(12-10-4-5-10)9-2-6-11(13)7-3-9;/h2-3,6-8,10,12-13H,4-5H2,1H3;1H

InChI key: InChIKey=AUZZSSLKUGEJJN-UHFFFAOYSA-N

SMILES: C(NC1CC1)(C)C2=CC=C(O)C=C2.Cl

Synonyms:

• Phenol, 4-[1-(cyclopropylamino)ethyl]-, hydrochloride (1:1)

4-[1-(Cyclopropylamino)ethyl]phenol hydrochloride

CAS: 1258641-43-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO

Purity: Min. 95%

Molecular weight: 213.7 g/mol

Ref: 3D-IAC64143