CAS 1258641-44-9

Benzenamine, 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-, hydrochloride (1:2)

Description:

Benzenamine, 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-, hydrochloride (1:2), with CAS number 1258641-44-9, is a chemical compound characterized by its complex structure that includes a benzenamine moiety and an imidazo[1,2-a]pyridine group. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the imidazo[1,2-a]pyridine structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as this scaffold is often associated with various biological activities, including antimicrobial and anticancer properties. The compound's molecular interactions are likely influenced by the functional groups present, which can participate in hydrogen bonding and other intermolecular forces. Additionally, the hydrochloride form indicates that it may be used in formulations requiring stability and ease of handling. Overall, this compound represents a class of organic molecules that are of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₃N₃O·2ClH

InChI: InChI=1S/C14H13N3O.2ClH/c15-11-4-3-5-13(8-11)18-10-12-9-17-7-2-1-6-14(17)16-12;;/h1-9H,10,15H2;2*1H

InChI key: InChIKey=PQXBHFJTKDYAKM-UHFFFAOYSA-N

SMILES: C(OC1=CC(N)=CC=C1)C=2N=C3N(C2)C=CC=C3.Cl

Synonyms:

• Benzenamine, 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-, hydrochloride (1:2)

3-{Imidazo[1,2-a]pyridin-2-ylmethoxy}aniline dihydrochloride

CAS: 1258641-44-9

Versatile small molecule scaffold

Formula: C₁₄H₁₅Cl₂N₃O

Purity: Min. 95%

Molecular weight: 312.2 g/mol

Ref: 3D-IAC64144