CAS 1258641-45-0

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-6,6,6-trifluorohexanoic acid

Description:

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-6,6,6-trifluorohexanoic acid is a synthetic organic compound characterized by its unique functional groups and fluorinated structure. It features a trifluoromethyl group, which imparts distinct electronic and lipophilic properties, enhancing its potential applications in pharmaceuticals and agrochemicals. The presence of the dimethylethoxycarbonyl group suggests that it may serve as a protective group in organic synthesis, facilitating the selective modification of amino acids or other reactive sites. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic characteristics, while the carboxylic acid functionality provides acidic properties, allowing for potential interactions in biological systems. Its molecular structure indicates that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, this compound's unique combination of fluorinated and functional groups positions it as a versatile candidate for further research and development in various chemical applications.

Formula: C₁₁H₁₈F₃NO₄

InChI: InChI=1S/C11H18F3NO4/c1-10(2,3)19-9(18)15-7(11(12,13)14)5-4-6-8(16)17/h7H,4-6H2,1-3H3,(H,15,18)(H,16,17)

InChI key: InChIKey=UZXKBFDRJWENDU-UHFFFAOYSA-N

SMILES: C(NC(OC(C)(C)C)=O)(CCCC(O)=O)C(F)(F)F

Synonyms:

• 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-6,6,6-trifluorohexanoic acid
• Hexanoic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-6,6,6-trifluoro-