CAS 1258641-49-4

Piperidine, 3-(2-thiazolyl)-, hydrochloride (1:2)

Description:

Piperidine, 3-(2-thiazolyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine, and a thiazole moiety, which is a five-membered ring containing both sulfur and nitrogen. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The thiazole group contributes to its biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. The presence of the hydrochloride indicates that it is a salt, which can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. As with many piperidine derivatives, it may exhibit various biological activities, including antimicrobial or anti-inflammatory effects, although specific activities would depend on further studies. Safety data and handling precautions should be observed, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₈H₁₂N₂S·2ClH

InChI: InChI=1S/C8H12N2S.2ClH/c1-2-7(6-9-3-1)8-10-4-5-11-8;;/h4-5,7,9H,1-3,6H2;2*1H

InChI key: InChIKey=OHXUAUUWVWJSOI-UHFFFAOYSA-N

SMILES: C1(=NC=CS1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-(2-thiazolyl)-, hydrochloride (1:2)