CymitQuimica logo

CAS 1258649-54-5

:

3-(Aminomethyl)octahydro-5-hydroxy-2(1H)-quinolinone

Description:
3-(Aminomethyl)octahydro-5-hydroxy-2(1H)-quinolinone is a chemical compound characterized by its complex bicyclic structure, which includes a quinolinone moiety. This substance features an amino group and a hydroxyl group, contributing to its potential as a bioactive molecule. The presence of the octahydro framework indicates that it is a saturated derivative, which may influence its solubility and reactivity. The compound's functional groups suggest it could participate in hydrogen bonding, making it of interest in medicinal chemistry for potential therapeutic applications. Its structural features may also impart specific pharmacological properties, such as activity against certain biological targets. The CAS number 1258649-54-5 uniquely identifies this compound in chemical databases, facilitating research and development efforts. Overall, the characteristics of this compound position it as a candidate for further investigation in various fields, including pharmaceuticals and organic synthesis.
Formula:C10H18N2O2
InChI:InChI=1S/C10H18N2O2/c11-5-6-4-7-8(12-10(6)14)2-1-3-9(7)13/h6-9,13H,1-5,11H2,(H,12,14)
InChI key:InChIKey=UJFPYNKDUZQDFS-UHFFFAOYSA-N
SMILES:OC1C2C(NC(=O)C(CN)C2)CCC1
Synonyms:
  • 2(1H)-Quinolinone, 3-(aminomethyl)octahydro-5-hydroxy-
  • 3-(Aminomethyl)octahydro-5-hydroxy-2(1H)-quinolinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.