CAS 1258649-70-5

3-Benzofuranamine, 2,3-dihydro-6,7-dimethyl-, hydrochloride (1:1)

Description:

3-Benzofuranamine, 2,3-dihydro-6,7-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features an amine functional group, contributing to its potential as a biological or pharmaceutical agent. The presence of methyl groups at the 6 and 7 positions of the benzofuran ring indicates that it is a dimethyl derivative, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory and pharmaceutical applications. The compound may exhibit various biological activities, potentially including effects on neurotransmitter systems, although specific pharmacological properties would require further investigation. Safety data and handling precautions should be observed, as with any chemical substance, particularly those with amine functionalities, which can be reactive and may pose health risks.

Formula: C₁₀H₁₃NO·ClH

InChI: InChI=1S/C10H13NO.ClH/c1-6-3-4-8-9(11)5-12-10(8)7(6)2;/h3-4,9H,5,11H2,1-2H3;1H

InChI key: InChIKey=AMRPALXVPNMFTD-UHFFFAOYSA-N

SMILES: CC1=C2C(C(N)CO2)=CC=C1C.Cl

Synonyms:

• 3-Benzofuranamine, 2,3-dihydro-6,7-dimethyl-, hydrochloride (1:1)

6,7-Dimethyl-2,3-dihydro-1-benzofuran-3-amine hydrochloride

CAS: 1258649-70-5

Versatile small molecule scaffold

Formula: C₁₀H₁₄ClNO

Purity: Min. 95%

Molecular weight: 199.68 g/mol

Ref: 3D-IAC64970