CAS 1258649-82-9

N-[5-Cyano-2-(methylsulfonyl)phenyl]acetamide

Description:

N-[5-Cyano-2-(methylsulfonyl)phenyl]acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a cyano group (-CN) and a methylsulfonyl group (-SO2CH3) attached to a phenyl ring, which contributes to its unique reactivity and potential applications in medicinal chemistry. The acetamide functional group (-CONH2) indicates that it can participate in various chemical reactions, including nucleophilic substitutions and acylation reactions. This compound may exhibit biological activity due to its structural components, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can be influenced by the presence of the cyano and sulfonyl groups, which can also affect its interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of the compound may vary based on its specific use and concentration. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₀H₁₀N₂O₃S

InChI: InChI=1S/C10H10N2O3S/c1-7(13)12-9-5-8(6-11)3-4-10(9)16(2,14)15/h3-5H,1-2H3,(H,12,13)

InChI key: InChIKey=DJTGDEAYWODXJC-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(S(C)(=O)=O)C=CC(C#N)=C1

Synonyms:

• N-[5-Cyano-2-(methylsulfonyl)phenyl]acetamide
• Acetamide, N-[5-cyano-2-(methylsulfonyl)phenyl]-

N-(5-Cyano-2-methanesulfonylphenyl)acetamide

CAS: 1258649-82-9

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O₃S

Purity: Min. 95%

Molecular weight: 238.27 g/mol

Ref: 3D-IAC64982