CymitQuimica logo

CAS 1258649-86-3

:

1-Propanamine, 3-(8-quinolinyloxy)-, hydrochloride (1:2)

Description:
1-Propanamine, 3-(8-quinolinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its amine functional group and the presence of a quinoline moiety, which contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound's structure suggests it may exhibit properties such as antimicrobial or antitumor activity, which is common among quinoline derivatives. Its molecular interactions can be influenced by the presence of the amine group, allowing for hydrogen bonding and other interactions with biological targets. The compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Further research may be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C12H14N2O·2ClH
InChI:InChI=1S/C12H14N2O.2ClH/c13-7-3-9-15-11-6-1-4-10-5-2-8-14-12(10)11;;/h1-2,4-6,8H,3,7,9,13H2;2*1H
InChI key:InChIKey=VSRJOLFYZVBUNM-UHFFFAOYSA-N
SMILES:O(CCCN)C=1C2=C(C=CC1)C=CC=N2.Cl
Synonyms:
  • 1-Propanamine, 3-(8-quinolinyloxy)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.