CAS 1258649-88-5

Piperazine, 1-[(2-methyl-4-thiazolyl)sulfonyl]-, hydrochloride (1:1)

Description:

Piperazine, 1-[(2-methyl-4-thiazolyl)sulfonyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. The presence of a thiazole ring, specifically a 2-methyl-4-thiazole moiety, contributes to its unique properties and potential biological activity. The sulfonyl group enhances its solubility and reactivity, making it suitable for various applications in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, which is advantageous for pharmaceutical formulations. This compound may exhibit pharmacological properties, including antimicrobial or antiparasitic activities, due to the structural features of both the piperazine and thiazole components. Its specific interactions and mechanisms of action would depend on the context of its use and the biological targets involved. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₈H₁₃N₃O₂S₂·ClH

InChI: InChI=1S/C8H13N3O2S2.ClH/c1-7-10-8(6-14-7)15(12,13)11-4-2-9-3-5-11;/h6,9H,2-5H2,1H3;1H

InChI key: InChIKey=ZNXGCVIEIXGPPA-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C=1N=C(C)SC1)N2CCNCC2.Cl

Synonyms:

• Piperazine, 1-[(2-methyl-4-thiazolyl)sulfonyl]-, hydrochloride (1:1)