
CAS 1258650-01-9
:4-(Trifluoromethyl)-4-piperidinamine
Description:
4-(Trifluoromethyl)-4-piperidinamine is a chemical compound characterized by the presence of a piperidine ring substituted with a trifluoromethyl group and an amine functional group. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can significantly influence the compound's reactivity and solubility. The piperidine ring, a six-membered saturated nitrogen-containing heterocycle, contributes to the compound's basicity and potential for forming hydrogen bonds. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its unique structure can affect its interaction with biological targets, potentially leading to applications in various therapeutic areas. Additionally, the presence of fluorine atoms often enhances metabolic stability and lipophilicity, which are desirable traits in drug design. As with many fluorinated compounds, safety and environmental considerations are important, given the potential for persistence and bioaccumulation. Overall, 4-(Trifluoromethyl)-4-piperidinamine represents a valuable scaffold for further exploration in chemical and pharmaceutical research.
Formula:C6H11F3N2
InChI:InChI=1S/C6H11F3N2/c7-6(8,9)5(10)1-3-11-4-2-5/h11H,1-4,10H2
InChI key:InChIKey=OWOLXDUIPBPYAW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1(N)CCNCC1
Synonyms:- 4-(Trifluoromethyl)-4-piperidinamine
- 4-Piperidinamine, 4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.