
CAS 1258650-06-4
:6-(Difluoromethyl)-3-azabicyclo[4.1.0]heptane
Description:
6-(Difluoromethyl)-3-azabicyclo[4.1.0]heptane is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring containing a nitrogen atom. The presence of the difluoromethyl group introduces significant electronegativity and steric effects, influencing the compound's reactivity and potential applications in medicinal chemistry. This compound is of interest due to its potential as a building block in the synthesis of pharmaceuticals, particularly in the development of compounds targeting neurological disorders. The bicyclic framework contributes to its rigidity, which can enhance binding interactions with biological targets. Additionally, the presence of fluorine atoms can improve metabolic stability and lipophilicity, making it a valuable candidate for drug design. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, although specific biological activity would require further investigation. Overall, 6-(Difluoromethyl)-3-azabicyclo[4.1.0]heptane represents a fascinating subject for research in organic and medicinal chemistry.
Formula:C7H11F2N
InChI:InChI=1S/C7H11F2N/c8-6(9)7-1-2-10-4-5(7)3-7/h5-6,10H,1-4H2
InChI key:InChIKey=PJMSQHVKWDGWIP-UHFFFAOYSA-N
SMILES:C(F)(F)C12C(C1)CNCC2
Synonyms:- 6-(Difluoromethyl)-3-azabicyclo[4.1.0]heptane
- 3-Azabicyclo[4.1.0]heptane, 6-(difluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.