CAS 1258650-14-4

Benzenecarboximidamide, 4-(1-pyrrolidinyl)-, hydrochloride (1:1)

Description:

Benzenecarboximidamide, 4-(1-pyrrolidinyl)-, hydrochloride (1:1), with the CAS number 1258650-14-4, is a chemical compound characterized by its structural features that include a benzenecarboximidamide moiety and a pyrrolidine ring. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the pyrrolidine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound may exhibit properties such as basicity, which is influenced by the amine functionality in the pyrrolidine ring. Additionally, the hydrochloride form indicates that it can be used in various formulations, potentially affecting its stability and bioavailability. As with many organic compounds, its reactivity and interactions can be influenced by the functional groups present, making it a subject of interest in both synthetic and applied chemistry contexts. Safety and handling precautions should be observed, as with all chemical substances.

Formula: C₁₁H₁₅N₃·ClH

InChI: InChI=1S/C11H15N3.ClH/c12-11(13)9-3-5-10(6-4-9)14-7-1-2-8-14;/h3-6H,1-2,7-8H2,(H3,12,13);1H

InChI key: InChIKey=VALKQTXVMFPVGJ-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC=C(C=C1)N2CCCC2.Cl

Synonyms:

• Benzenecarboximidamide, 4-(1-pyrrolidinyl)-, hydrochloride (1:1)

4-(Pyrrolidin-1-yl)benzene-1-carboximidamide hydrochloride

CAS: 1258650-14-4

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClN₃

Purity: Min. 95%

Molecular weight: 225.72 g/mol

Ref: 3D-IAC65014