CAS 1258650-16-6

3-Pyridinecarbonitrile, 6-[(3-pyrrolidinylmethyl)amino]-, hydrochloride (1:1)

Description:

3-Pyridinecarbonitrile, 6-[(3-pyrrolidinylmethyl)amino]-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and pyrrolidine moieties, which contribute to its biological activity and potential pharmacological properties. The presence of the pyridine ring provides a basic nitrogen atom, while the carbonitrile group enhances its reactivity and solubility in polar solvents. The hydrochloride form indicates that the compound is a salt, which typically improves its stability and solubility in aqueous solutions. This compound may exhibit properties such as being a potential ligand for biological targets, making it of interest in medicinal chemistry. Its structure suggests possible interactions with various biological systems, potentially influencing neurotransmitter pathways or other physiological processes. As with many compounds containing nitrogen heterocycles, it may also display a range of activities, including antimicrobial or anti-inflammatory effects. However, specific biological activities and safety profiles would require further investigation through experimental studies.

Formula: C₁₁H₁₄N₄·ClH

InChI: InChI=1S/C11H14N4.ClH/c12-5-9-1-2-11(14-7-9)15-8-10-3-4-13-6-10;/h1-2,7,10,13H,3-4,6,8H2,(H,14,15);1H

InChI key: InChIKey=DDEBLSQJKVYPQG-UHFFFAOYSA-N

SMILES: N(CC1CCNC1)C2=CC=C(C#N)C=N2.Cl

Synonyms:

• 3-Pyridinecarbonitrile, 6-[(3-pyrrolidinylmethyl)amino]-, hydrochloride (1:1)

6-[(Pyrrolidin-3-ylmethyl)amino]pyridine-3-carbonitrile hydrochloride

CAS: 1258650-16-6

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClN₄

Purity: Min. 95%

Molecular weight: 238.72 g/mol

Ref: 3D-IAC65016