CAS 1258650-17-7

5,6,7,8-Tetrahydro-4-(4-morpholinyl)pyrido[4,3-d]pyrimidine

Description:

5,6,7,8-Tetrahydro-4-(4-morpholinyl)pyrido[4,3-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the rings, contributing to its stability and solubility in various solvents. The morpholine group attached to the pyridine ring enhances its potential for biological activity, as morpholines are known for their ability to interact with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to modulate biological pathways. Additionally, its unique arrangement of nitrogen atoms within the rings may influence its electronic properties and reactivity, making it a subject of interest for further research in drug design and synthesis. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the realm of organic chemistry.

Formula: C₁₁H₁₆N₄O

InChI: InChI=1S/C11H16N4O/c1-2-12-7-9-10(1)13-8-14-11(9)15-3-5-16-6-4-15/h8,12H,1-7H2

InChI key: InChIKey=ICORGBQIQCSEBP-UHFFFAOYSA-N

SMILES: C1(=C2C(=NC=N1)CCNC2)N3CCOCC3

Synonyms:

• Pyrido[4,3-d]pyrimidine, 5,6,7,8-tetrahydro-4-(4-morpholinyl)-
• 5,6,7,8-Tetrahydro-4-(4-morpholinyl)pyrido[4,3-d]pyrimidine

4-{5H,6H,7H,8H-Pyrido[4,3-d]pyrimidin-4-yl}morpholine

CAS: 1258650-17-7

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₄O

Purity: Min. 95%

Molecular weight: 220.27 g/mol

Ref: 3D-IAC65017