CAS 1258650-20-2

3-[(2-Chlorophenyl)methoxy]benzeneacetic acid

Description:

3-[(2-Chlorophenyl)methoxy]benzeneacetic acid, identified by its CAS number 1258650-20-2, is an organic compound characterized by its aromatic structure and functional groups. It features a benzeneacetic acid backbone, which is substituted with a methoxy group and a chlorophenyl moiety. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The chlorophenyl group introduces electron-withdrawing characteristics, which can affect the compound's reactivity and interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with various biological pathways. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, the unique combination of functional groups in 3-[(2-Chlorophenyl)methoxy]benzeneacetic acid suggests potential applications in drug development and research.

Formula: C₁₅H₁₃ClO₃

InChI: InChI=1S/C15H13ClO3/c16-14-7-2-1-5-12(14)10-19-13-6-3-4-11(8-13)9-15(17)18/h1-8H,9-10H2,(H,17,18)

InChI key: InChIKey=KTKKTWYBSNJANI-UHFFFAOYSA-N

SMILES: C(OC1=CC(CC(O)=O)=CC=C1)C2=C(Cl)C=CC=C2

Synonyms:

• 3-[(2-Chlorophenyl)methoxy]benzeneacetic acid
• Benzeneacetic acid, 3-[(2-chlorophenyl)methoxy]-

2-{3-[(2-Chlorophenyl)methoxy]phenyl}acetic acid

CAS: 1258650-20-2

Versatile small molecule scaffold

Formula: C₁₅H₁₃ClO₃

Purity: Min. 95%

Molecular weight: 276.71 g/mol

Ref: 3D-IAC65020