CAS 1258650-26-8

Benzenepropanoic acid, α-(aminomethyl)-3-methyl-, methyl ester, hydrochloride (1:1)

Description:

Benzenepropanoic acid, α-(aminomethyl)-3-methyl-, methyl ester, hydrochloride (1:1), commonly referred to as a derivative of phenylpropanoic acid, is a chemical compound characterized by its aromatic structure and the presence of both an amino group and a carboxylic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, such as solubility in polar solvents and potential for hydrogen bonding. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility in aqueous environments. The presence of the methyl ester group suggests that it may have applications in organic synthesis or as a pharmaceutical intermediate. Additionally, the compound may exhibit biological activity due to the amino group, which can participate in various biochemical interactions. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the presence of functional groups, making it relevant in medicinal chemistry and related fields.

Formula: C₁₂H₁₇NO₂·ClH

InChI: InChI=1S/C12H17NO2.ClH/c1-9-4-3-5-10(6-9)7-11(8-13)12(14)15-2;/h3-6,11H,7-8,13H2,1-2H3;1H

InChI key: InChIKey=FPDMCIQWYCNVCG-UHFFFAOYSA-N

SMILES: C(C(C(OC)=O)CN)C1=CC(C)=CC=C1.Cl

Synonyms:

• Benzenepropanoic acid, α-(aminomethyl)-3-methyl-, methyl ester, hydrochloride (1:1)

Methyl 3-amino-2-[(3-methylphenyl)methyl]propanoate hydrochloride

CAS: 1258650-26-8

Versatile small molecule scaffold

Formula: C₁₂H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 243.73 g/mol

Ref: 3D-IAC65026