CAS 1258650-32-6

N-[[4-(2-Amino-2-oxoethoxy)phenyl]methyl]-2-chloroacetamide

Description:

N-[[4-(2-Amino-2-oxoethoxy)phenyl]methyl]-2-chloroacetamide is a chemical compound characterized by its specific functional groups and structural features. It contains an amide functional group, which is indicative of its potential reactivity and biological activity. The presence of a chloroacetamide moiety suggests that it may exhibit properties typical of halogenated amides, such as increased lipophilicity and potential for nucleophilic substitution reactions. The compound also features an amino group, which can participate in hydrogen bonding and may influence its solubility and interaction with biological targets. The ethoxy group contributes to the overall hydrophilicity of the molecule, potentially affecting its pharmacokinetic properties. Given its structural complexity, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of functional groups may also lend itself to various synthetic applications in organic chemistry. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₁H₁₃ClN₂O₃

InChI: InChI=1S/C11H13ClN2O3/c12-5-11(16)14-6-8-1-3-9(4-2-8)17-7-10(13)15/h1-4H,5-7H2,(H2,13,15)(H,14,16)

InChI key: InChIKey=JFHMFLNYXIRICN-UHFFFAOYSA-N

SMILES: C(NC(CCl)=O)C1=CC=C(OCC(N)=O)C=C1

Synonyms:

• Acetamide, N-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-2-chloro-
• N-[[4-(2-Amino-2-oxoethoxy)phenyl]methyl]-2-chloroacetamide

N-{[4-(Carbamoylmethoxy)phenyl]methyl}-2-chloroacetamide

CAS: 1258650-32-6

Versatile small molecule scaffold

Formula: C₁₁H₁₃ClN₂O₃

Purity: Min. 95%

Molecular weight: 256.68 g/mol

Ref: 3D-IAC65032