CAS 1258650-42-8

4-[(3,5-Dimethyl-1-piperidinyl)sulfonyl]benzenesulfonyl chloride

Description:

4-[(3,5-Dimethyl-1-piperidinyl)sulfonyl]benzenesulfonyl chloride, with the CAS number 1258650-42-8, is a sulfonamide compound characterized by the presence of two sulfonyl groups attached to a benzene ring. This compound features a piperidine moiety, which contributes to its potential biological activity and solubility properties. The sulfonyl chloride functional group indicates that it is reactive, particularly with nucleophiles, making it useful in various synthetic applications, including the formation of sulfonamides. The presence of the dimethyl substituents on the piperidine ring may influence its steric and electronic properties, potentially affecting its reactivity and interaction with biological targets. This compound is typically handled with care due to its reactivity and potential hazards associated with sulfonyl chlorides, which can release hydrochloric acid upon hydrolysis. Overall, its unique structure suggests applications in medicinal chemistry and material science, where sulfonyl groups are often utilized for enhancing solubility and biological activity.

Formula: C₁₃H₁₈ClNO₄S₂

InChI: InChI=1S/C13H18ClNO4S2/c1-10-7-11(2)9-15(8-10)21(18,19)13-5-3-12(4-6-13)20(14,16)17/h3-6,10-11H,7-9H2,1-2H3

InChI key: InChIKey=NPLZZEGSEGSKMF-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1CC(C)CC(C)C1)C2=CC=C(S(Cl)(=O)=O)C=C2

Synonyms:

• 4-[(3,5-Dimethyl-1-piperidinyl)sulfonyl]benzenesulfonyl chloride
• Benzenesulfonyl chloride, 4-[(3,5-dimethyl-1-piperidinyl)sulfonyl]-