CAS 1258650-46-2

2-[(2-Propen-1-ylamino)carbonyl]-4-thiazolecarboxylic acid

Description:

2-[(2-Propen-1-ylamino)carbonyl]-4-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group attached to a propenyl chain, contributing to its reactivity and potential biological activity. The carboxylic acid functional group enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. The presence of the thiazole moiety suggests potential applications in pharmaceuticals, as thiazole derivatives are often associated with antimicrobial and anti-inflammatory properties. Additionally, the compound's structure indicates it may engage in hydrogen bonding due to the carboxylic acid group, influencing its interactions in biological systems. Overall, this compound's unique structural features may provide avenues for research in medicinal chemistry and material science, although specific applications would depend on further studies and evaluations of its properties and activities.

Formula: C₈H₈N₂O₃S

InChI: InChI=1S/C8H8N2O3S/c1-2-3-9-6(11)7-10-5(4-14-7)8(12)13/h2,4H,1,3H2,(H,9,11)(H,12,13)

InChI key: InChIKey=XHFTZXACCMHJII-UHFFFAOYSA-N

SMILES: C(NCC=C)(=O)C1=NC(C(O)=O)=CS1

Synonyms:

• 4-Thiazolecarboxylic acid, 2-[(2-propen-1-ylamino)carbonyl]-
• 2-[(2-Propen-1-ylamino)carbonyl]-4-thiazolecarboxylic acid

2-[(Prop-2-en-1-yl)carbamoyl]-1,3-thiazole-4-carboxylic acid

CAS: 1258650-46-2

Versatile small molecule scaffold

Formula: C₈H₈N₂O₃S

Purity: Min. 95%

Molecular weight: 212.23 g/mol

Ref: 3D-IAC65046